About 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol
2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol (PubChem CID 3723683) has the molecular formula C23H20N2O3
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol.
Molecular Properties
| Compound Name | 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol |
| PubChem CID | 3723683 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol |
| SMILES | COc1cccc(-c2nc(Oc3cccc(C)c3C)c3ccccc3n2)c1O |
| InChI | InChI=1S/C23H20N2O3/c1-14-8-6-12-19(15(14)2)28-23-16-9-4-5-11-18(16)24-22(25-23)17-10-7-13-20(27-3)21(17)26/h4-13,26H,1-3H3 |
| InChIKey | MEEZGWNRFNKLSC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol?
The IUPAC name of 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol (CID 3723683) is 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol.
What is the SMILES notation for 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol?
The canonical SMILES for 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol is COc1cccc(-c2nc(Oc3cccc(C)c3C)c3ccccc3n2)c1O.
What is the InChIKey of 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol?
The InChIKey is MEEZGWNRFNKLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O3/c1-14-8-6-12-19(15(14)2)28-23-16-9-4-5-11-18(16)24-22(25-23)17-10-7-13-20(27-3)21(17)26/h4-13,26H,1-3H3.
What are the key properties of 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol?
2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol has a molecular weight of 372.42 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-dimethylphenoxy)quinazolin-2-yl]-6-methoxyphenol is sourced from PubChem (CID 3723683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).