About N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide
N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 37249311) has the molecular formula C18H17FN4O3S
and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| PubChem CID | 37249311 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C18H17FN4O3S/c19-15-5-1-2-6-16(15)23-18(22-8-3-4-9-22)14(11-20-23)17(24)21-13-7-10-27(25,26)12-13/h1-6,8-9,11,13H,7,10,12H2,(H,21,24)/t13-/m1/s1 |
| InChIKey | UCXJPLDLKZXCKG-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide?
The IUPAC name of N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (CID 37249311) is N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
What is the SMILES notation for N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide?
The canonical SMILES for N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide is O=C(N[C@@H]1CCS(=O)(=O)C1)c1cnn(-c2ccccc2F)c1-n1cccc1.
What is the InChIKey of N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide?
The InChIKey is UCXJPLDLKZXCKG-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H17FN4O3S/c19-15-5-1-2-6-16(15)23-18(22-8-3-4-9-22)14(11-20-23)17(24)21-13-7-10-27(25,26)12-13/h1-6,8-9,11,13H,7,10,12H2,(H,21,24)/t13-/m1/s1.
What are the key properties of N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide?
N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide has a molecular weight of 388.42 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1,1-dioxothiolan-3-yl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide is sourced from PubChem (CID 37249311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).