C26H18ClFN2S — CID 3724944
13-(4-chlorophenyl)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene (PubChem CID 3724944) has the molecular formula C26H18ClFN2S and a molecular weight of 444.96 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene.
| Compound Name | 13-(4-chlorophenyl)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
|---|---|
| PubChem CID | 3724944 |
| Molecular Formula | C26H18ClFN2S |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 13-(4-chlorophenyl)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
| SMILES | Fc1ccc(C2C3=C(N=C4SC=C(c5ccc(Cl)cc5)N42)c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C26H18ClFN2S/c27-19-10-5-17(6-11-19)23-15-31-26-29-24-21-4-2-1-3-16(21)9-14-22(24)25(30(23)26)18-7-12-20(28)13-8-18/h1-8,10-13,15,25H,9,14H2 |
| InChIKey | RLYGPIXLJUPEKH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |