C28H25N5O3 — CID 37249746
10-[2-oxo-2-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]acridin-9-one (PubChem CID 37249746) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 10-[2-oxo-2-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]acridin-9-one.
| Compound Name | 10-[2-oxo-2-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]acridin-9-one |
|---|---|
| PubChem CID | 37249746 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 10-[2-oxo-2-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]acridin-9-one |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N1CCN(Cc2nc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C28H25N5O3/c34-26(19-33-23-12-6-4-10-21(23)27(35)22-11-5-7-13-24(22)33)32-16-14-31(15-17-32)18-25-29-28(30-36-25)20-8-2-1-3-9-20/h1-13H,14-19H2 |
| InChIKey | HHJHFYMADFFINF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|