C16H15N3O2S — CID 3725718
2-pyridin-3-ylsulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 3725718) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-pyridin-3-ylsulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-pyridin-3-ylsulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3725718 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-pyridin-3-ylsulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=S(=O)(c1cccnc1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H15N3O2S/c20-22(21,12-4-3-8-17-10-12)19-9-7-14-13-5-1-2-6-15(13)18-16(14)11-19/h1-6,8,10,18H,7,9,11H2 |
| InChIKey | SFDMXJSZLICSNR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|