C25H23NO3 — CID 3726588
2-(4-methoxyanilino)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione (PubChem CID 3726588) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione.
| Compound Name | 2-(4-methoxyanilino)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 3726588 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-(4-methoxyanilino)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione |
| SMILES | COc1ccc(NC(=CC(=O)c2ccc(C)cc2)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-17-4-8-19(9-5-17)24(27)16-23(25(28)20-10-6-18(2)7-11-20)26-21-12-14-22(29-3)15-13-21/h4-16,26H,1-3H3 |
| InChIKey | NFSASKGMHRCVQK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|