C8H7F6N3O2 — CID 3726631
2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-amine (PubChem CID 3726631) has the molecular formula C8H7F6N3O2 and a molecular weight of 291.15 g/mol. Its IUPAC name is 2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-amine.
| Compound Name | 2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3726631 |
| Molecular Formula | C8H7F6N3O2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
| SMILES | Nc1cc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H7F6N3O2/c9-7(10,11)2-18-5-1-4(15)16-6(17-5)19-3-8(12,13)14/h1H,2-3H2,(H2,15,16,17) |
| InChIKey | JSFVAXLTSHHOKI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |