C28H21N5O3 — CID 3726749
9-(2,4-dimethylbenzoyl)-8-(3-nitrophenyl)-8,9-dihydro-6aH-pyrrolo[1,2-a][1,5]naphthyridine-7,7-dicarbonitrile (PubChem CID 3726749) has the molecular formula C28H21N5O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 9-(2,4-dimethylbenzoyl)-8-(3-nitrophenyl)-8,9-dihydro-6aH-pyrrolo[1,2-a][1,5]naphthyridine-7,7-dicarbonitrile.
| Compound Name | 9-(2,4-dimethylbenzoyl)-8-(3-nitrophenyl)-8,9-dihydro-6aH-pyrrolo[1,2-a][1,5]naphthyridine-7,7-dicarbonitrile |
|---|---|
| PubChem CID | 3726749 |
| Molecular Formula | C28H21N5O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 9-(2,4-dimethylbenzoyl)-8-(3-nitrophenyl)-8,9-dihydro-6aH-pyrrolo[1,2-a][1,5]naphthyridine-7,7-dicarbonitrile |
| SMILES | Cc1ccc(C(=O)C2C(c3cccc([N+](=O)[O-])c3)C(C#N)(C#N)C3C=Cc4ncccc4N23)c(C)c1 |
| InChI | InChI=1S/C28H21N5O3/c1-17-8-9-21(18(2)13-17)27(34)26-25(19-5-3-6-20(14-19)33(35)36)28(15-29,16-30)24-11-10-22-23(32(24)26)7-4-12-31-22/h3-14,24-26H,1-2H3 |
| InChIKey | CJCSCIUXVRFEFX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 123.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|