C22H19N5O7S2 — CID 3726862
4-[[2-(4-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrol-4-yl]amino]benzenesulfonamide (PubChem CID 3726862) has the molecular formula C22H19N5O7S2 and a molecular weight of 529.56 g/mol. Its IUPAC name is 4-[[2-(4-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrol-4-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[2-(4-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrol-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 3726862 |
| Molecular Formula | C22H19N5O7S2 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 4-[[2-(4-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-2H-pyrrol-4-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2=CC(c3ccc([N+](=O)[O-])cc3)N(c3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H19N5O7S2/c23-35(31,32)18-9-3-15(4-10-18)25-20-13-21(14-1-5-17(6-2-14)27(29)30)26(22(20)28)16-7-11-19(12-8-16)36(24,33)34/h1-13,21,25H,(H2,23,31,32)(H2,24,33,34) |
| InChIKey | JDAGQSBEKGIRTM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 195.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|