About 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide
4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 3726993) has the molecular formula C16H16F3NO2S
and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
| PubChem CID | 3726993 |
| Molecular Formula | C16H16F3NO2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NCc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H16F3NO2S/c1-10(2)11-3-6-13(7-4-11)23(21,22)20-9-12-5-8-14(17)16(19)15(12)18/h3-8,10,20H,9H2,1-2H3 |
| InChIKey | FNGFJZLJIUQNPW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide?
The IUPAC name of 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide (CID 3726993) is 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide?
The canonical SMILES for 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide is CC(C)c1ccc(S(=O)(=O)NCc2ccc(F)c(F)c2F)cc1.
What is the InChIKey of 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide?
The InChIKey is FNGFJZLJIUQNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3NO2S/c1-10(2)11-3-6-13(7-4-11)23(21,22)20-9-12-5-8-14(17)16(19)15(12)18/h3-8,10,20H,9H2,1-2H3.
What are the key properties of 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide?
4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide has a molecular weight of 343.37 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide is sourced from PubChem (CID 3726993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).