C25H26N4O7S — CID 3727162
methyl 2-amino-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-6,8-dihydro-4H-quinoline-3-carboxylate (PubChem CID 3727162) has the molecular formula C25H26N4O7S and a molecular weight of 526.57 g/mol. Its IUPAC name is methyl 2-amino-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-6,8-dihydro-4H-quinoline-3-carboxylate.
| Compound Name | methyl 2-amino-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-6,8-dihydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3727162 |
| Molecular Formula | C25H26N4O7S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | methyl 2-amino-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1-(4-sulfamoylphenyl)-6,8-dihydro-4H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccc(S(N)(=O)=O)cc2)C2=C(C(=O)CC(C)(C)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N4O7S/c1-25(2)12-18-21(19(30)13-25)20(14-5-4-6-16(11-14)29(32)33)22(24(31)36-3)23(26)28(18)15-7-9-17(10-8-15)37(27,34)35/h4-11,20H,12-13,26H2,1-3H3,(H2,27,34,35) |
| InChIKey | YYNZPRCILPAXBH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 175.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|