About N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide (PubChem CID 3727405) has the molecular formula C10H9ClF3N3O
and a molecular weight of 279.65 g/mol. Its IUPAC name is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide |
| PubChem CID | 3727405 |
| Molecular Formula | C10H9ClF3N3O |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide |
| SMILES | C=CC(=O)NN(C)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9ClF3N3O/c1-3-8(18)16-17(2)9-7(11)4-6(5-15-9)10(12,13)14/h3-5H,1H2,2H3,(H,16,18) |
| InChIKey | DQIKQVXPIGLXOK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide?
The IUPAC name of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide (CID 3727405) is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide.
What is the SMILES notation for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide?
The canonical SMILES for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide is C=CC(=O)NN(C)c1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide?
The InChIKey is DQIKQVXPIGLXOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF3N3O/c1-3-8(18)16-17(2)9-7(11)4-6(5-15-9)10(12,13)14/h3-5H,1H2,2H3,(H,16,18).
What are the key properties of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide?
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide has a molecular weight of 279.65 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide is sourced from PubChem (CID 3727405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).