About 4-fluoro-2,3,5,6-tetramethylaniline
4-fluoro-2,3,5,6-tetramethylaniline (PubChem CID 3728185) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 4-fluoro-2,3,5,6-tetramethylaniline.
Molecular Properties
| Compound Name | 4-fluoro-2,3,5,6-tetramethylaniline |
| PubChem CID | 3728185 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-fluoro-2,3,5,6-tetramethylaniline |
| SMILES | Cc1c(C)c(F)c(C)c(C)c1N |
| InChI | InChI=1S/C10H14FN/c1-5-7(3)10(12)8(4)6(2)9(5)11/h12H2,1-4H3 |
| InChIKey | OTZXMVFEAZECDY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2,3,5,6-tetramethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3,5,6-tetramethylaniline?
The IUPAC name of 4-fluoro-2,3,5,6-tetramethylaniline (CID 3728185) is 4-fluoro-2,3,5,6-tetramethylaniline.
What is the SMILES notation for 4-fluoro-2,3,5,6-tetramethylaniline?
The canonical SMILES for 4-fluoro-2,3,5,6-tetramethylaniline is Cc1c(C)c(F)c(C)c(C)c1N.
What is the InChIKey of 4-fluoro-2,3,5,6-tetramethylaniline?
The InChIKey is OTZXMVFEAZECDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c1-5-7(3)10(12)8(4)6(2)9(5)11/h12H2,1-4H3.
What are the key properties of 4-fluoro-2,3,5,6-tetramethylaniline?
4-fluoro-2,3,5,6-tetramethylaniline has a molecular weight of 167.23 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3,5,6-tetramethylaniline is sourced from PubChem (CID 3728185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).