C14H18BrNO — CID 3728666
N-(2-bromo-4-methylphenyl)cyclohexanecarboxamide (PubChem CID 3728666) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)cyclohexanecarboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3728666 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)cyclohexanecarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H18BrNO/c1-10-7-8-13(12(15)9-10)16-14(17)11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H,16,17) |
| InChIKey | QLTMMCXJWXDIFT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |