C16H19BrN4O3S — CID 37287270
3-(4-bromophenyl)-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide (PubChem CID 37287270) has the molecular formula C16H19BrN4O3S and a molecular weight of 427.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 37287270 |
| Molecular Formula | C16H19BrN4O3S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-(4-bromophenyl)-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)CC1 |
| InChI | InChI=1S/C16H19BrN4O3S/c1-25(23,24)21-8-6-13(7-9-21)18-16(22)15-10-14(19-20-15)11-2-4-12(17)5-3-11/h2-5,10,13H,6-9H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | OWUBUPUFAKJLHY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |