About 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one
3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one (PubChem CID 3729446) has the molecular formula C14H13NO2S2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
| PubChem CID | 3729446 |
| Molecular Formula | C14H13NO2S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CSC2c2cccs2)cc1 |
| InChI | InChI=1S/C14H13NO2S2/c1-17-11-6-4-10(5-7-11)15-13(16)9-19-14(15)12-3-2-8-18-12/h2-8,14H,9H2,1H3 |
| InChIKey | QBICGKPVLXXOFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one (CID 3729446) is 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one is COc1ccc(N2C(=O)CSC2c2cccs2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
The InChIKey is QBICGKPVLXXOFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S2/c1-17-11-6-4-10(5-7-11)15-13(16)9-19-14(15)12-3-2-8-18-12/h2-8,14H,9H2,1H3.
What are the key properties of 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one?
3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one has a molecular weight of 291.40 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3729446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).