C25H28N4O3S2 — CID 3730912
2-(1-cyclohexyl-3-methyl-5-oxopyrazol-4-ylidene)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3730912) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-(1-cyclohexyl-3-methyl-5-oxopyrazol-4-ylidene)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-cyclohexyl-3-methyl-5-oxopyrazol-4-ylidene)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3730912 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-(1-cyclohexyl-3-methyl-5-oxopyrazol-4-ylidene)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCn1c(=C2C(=O)N(C3CCCCC3)N=C2C)sc(=C2Sc3ccc(OC)cc3N2C)c1=O |
| InChI | InChI=1S/C25H28N4O3S2/c1-5-13-28-23(31)21(25-27(3)18-14-17(32-4)11-12-19(18)33-25)34-24(28)20-15(2)26-29(22(20)30)16-9-7-6-8-10-16/h5,11-12,14,16H,1,6-10,13H2,2-4H3 |
| InChIKey | ICCVOWWVCUWLPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|