About diphenyl(1,2-thiazol-5-yl)methanol
diphenyl(1,2-thiazol-5-yl)methanol (PubChem CID 3731134) has the molecular formula C16H13NOS
and a molecular weight of 267.35 g/mol. Its IUPAC name is diphenyl(1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | diphenyl(1,2-thiazol-5-yl)methanol |
| PubChem CID | 3731134 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | diphenyl(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1ccns1 |
| InChI | InChI=1S/C16H13NOS/c18-16(15-11-12-17-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,18H |
| InChIKey | XURHFRDMUSMMNV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diphenyl(1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl(1,2-thiazol-5-yl)methanol?
The IUPAC name of diphenyl(1,2-thiazol-5-yl)methanol (CID 3731134) is diphenyl(1,2-thiazol-5-yl)methanol.
What is the SMILES notation for diphenyl(1,2-thiazol-5-yl)methanol?
The canonical SMILES for diphenyl(1,2-thiazol-5-yl)methanol is OC(c1ccccc1)(c1ccccc1)c1ccns1.
What is the InChIKey of diphenyl(1,2-thiazol-5-yl)methanol?
The InChIKey is XURHFRDMUSMMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NOS/c18-16(15-11-12-17-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,18H.
What are the key properties of diphenyl(1,2-thiazol-5-yl)methanol?
diphenyl(1,2-thiazol-5-yl)methanol has a molecular weight of 267.35 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl(1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 3731134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).