About N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline
N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline (PubChem CID 3731188) has the molecular formula C25H32Cl2NO3P
and a molecular weight of 496.42 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline.
Molecular Properties
| Compound Name | N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline |
| PubChem CID | 3731188 |
| Molecular Formula | C25H32Cl2NO3P |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline |
| SMILES | O=P(OC1CCCCC1)(OC1CCCCC1)C(Nc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H32Cl2NO3P/c26-19-16-17-23(24(27)18-19)25(28-20-10-4-1-5-11-20)32(29,30-21-12-6-2-7-13-21)31-22-14-8-3-9-15-22/h1,4-5,10-11,16-18,21-22,25,28H,2-3,6-9,12-15H2 |
| InChIKey | XAXNLAUKGGNUCW-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline?
The IUPAC name of N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline (CID 3731188) is N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline.
What is the SMILES notation for N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline?
The canonical SMILES for N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline is O=P(OC1CCCCC1)(OC1CCCCC1)C(Nc1ccccc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline?
The InChIKey is XAXNLAUKGGNUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32Cl2NO3P/c26-19-16-17-23(24(27)18-19)25(28-20-10-4-1-5-11-20)32(29,30-21-12-6-2-7-13-21)31-22-14-8-3-9-15-22/h1,4-5,10-11,16-18,21-22,25,28H,2-3,6-9,12-15H2.
What are the key properties of N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline?
N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline has a molecular weight of 496.42 g/mol, XLogP of 9.00, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichlorophenyl)-dicyclohexyloxyphosphorylmethyl]aniline is sourced from PubChem (CID 3731188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).