About 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one
2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one (PubChem CID 3731289) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one |
| PubChem CID | 3731289 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(O)C(c2ccc(C)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-16-6-10-18(11-7-16)20(23-14-4-3-5-15-23)22(25)21(24)19-12-8-17(2)9-13-19/h6-13,20,22,25H,3-5,14-15H2,1-2H3 |
| InChIKey | QIAUEJSGCORVTR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one?
The IUPAC name of 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one (CID 3731289) is 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one.
What is the SMILES notation for 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one?
The canonical SMILES for 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one is Cc1ccc(C(=O)C(O)C(c2ccc(C)cc2)N2CCCCC2)cc1.
What is the InChIKey of 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one?
The InChIKey is QIAUEJSGCORVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-16-6-10-18(11-7-16)20(23-14-4-3-5-15-23)22(25)21(24)19-12-8-17(2)9-13-19/h6-13,20,22,25H,3-5,14-15H2,1-2H3.
What are the key properties of 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one?
2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one has a molecular weight of 337.46 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3-bis(4-methylphenyl)-3-piperidin-1-ylpropan-1-one is sourced from PubChem (CID 3731289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).