C22H25N5O3 — CID 37314856
N-[3-[benzyl(methyl)amino]propyl]-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 37314856) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 37314856 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(CCCNC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2C1CC1)Cc1ccccc1 |
| InChI | InChI=1S/C22H25N5O3/c1-26(14-15-6-3-2-4-7-15)11-5-10-23-20(28)16-12-18-19(24-13-16)27(17-8-9-17)22(30)25-21(18)29/h2-4,6-7,12-13,17H,5,8-11,14H2,1H3,(H,23,28)(H,25,29,30) |
| InChIKey | HJJLSGFRBVCJTJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|