About tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate
tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate (PubChem CID 3731532) has the molecular formula C12H17Br2NO4S2
and a molecular weight of 463.21 g/mol. Its IUPAC name is tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate |
| PubChem CID | 3731532 |
| Molecular Formula | C12H17Br2NO4S2 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2NO4S2/c1-12(2,3)19-9(16)5-4-6-15-21(17,18)10-7-8(13)11(14)20-10/h7,15H,4-6H2,1-3H3 |
| InChIKey | SPEMMNOOPAMQIZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate?
The IUPAC name of tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate (CID 3731532) is tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate.
What is the SMILES notation for tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate?
The canonical SMILES for tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate is CC(C)(C)OC(=O)CCCNS(=O)(=O)c1cc(Br)c(Br)s1.
What is the InChIKey of tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate?
The InChIKey is SPEMMNOOPAMQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br2NO4S2/c1-12(2,3)19-9(16)5-4-6-15-21(17,18)10-7-8(13)11(14)20-10/h7,15H,4-6H2,1-3H3.
What are the key properties of tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate?
tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate has a molecular weight of 463.21 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(4,5-dibromothiophen-2-yl)sulfonylamino]butanoate is sourced from PubChem (CID 3731532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).