C17H14N4O2S — CID 37315590
3-(furan-2-yl)-5-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 37315590) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(furan-2-yl)-5-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 37315590 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-(furan-2-yl)-5-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | C=CCn1c(SCc2nc(-c3ccco3)no2)nc2ccccc21 |
| InChI | InChI=1S/C17H14N4O2S/c1-2-9-21-13-7-4-3-6-12(13)18-17(21)24-11-15-19-16(20-23-15)14-8-5-10-22-14/h2-8,10H,1,9,11H2 |
| InChIKey | GSURIBKMDAKQCF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|