C17H16F3N3O4 — CID 3732069
methyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)carbamoylamino]-2-phenoxypropanoate (PubChem CID 3732069) has the molecular formula C17H16F3N3O4 and a molecular weight of 383.33 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)carbamoylamino]-2-phenoxypropanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)carbamoylamino]-2-phenoxypropanoate |
|---|---|
| PubChem CID | 3732069 |
| Molecular Formula | C17H16F3N3O4 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)carbamoylamino]-2-phenoxypropanoate |
| SMILES | COC(=O)C(NC(=O)Nc1ccc(C)cn1)(Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O4/c1-11-8-9-13(21-10-11)22-15(25)23-16(14(24)26-2,17(18,19)20)27-12-6-4-3-5-7-12/h3-10H,1-2H3,(H2,21,22,23,25) |
| InChIKey | BCNUFLBXWLGEMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|