About 2-(3-chlorophenyl)-1,1-dimethylguanidine
2-(3-chlorophenyl)-1,1-dimethylguanidine (PubChem CID 3732126) has the molecular formula C9H12ClN3
and a molecular weight of 197.67 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-1,1-dimethylguanidine |
| PubChem CID | 3732126 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H12ClN3/c1-13(2)9(11)12-8-5-3-4-7(10)6-8/h3-6H,1-2H3,(H2,11,12) |
| InChIKey | HNIDNQGBEAELQX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenyl)-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-1,1-dimethylguanidine?
The IUPAC name of 2-(3-chlorophenyl)-1,1-dimethylguanidine (CID 3732126) is 2-(3-chlorophenyl)-1,1-dimethylguanidine.
What is the SMILES notation for 2-(3-chlorophenyl)-1,1-dimethylguanidine?
The canonical SMILES for 2-(3-chlorophenyl)-1,1-dimethylguanidine is CN(C)/C(N)=N/c1cccc(Cl)c1.
What is the InChIKey of 2-(3-chlorophenyl)-1,1-dimethylguanidine?
The InChIKey is HNIDNQGBEAELQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN3/c1-13(2)9(11)12-8-5-3-4-7(10)6-8/h3-6H,1-2H3,(H2,11,12).
What are the key properties of 2-(3-chlorophenyl)-1,1-dimethylguanidine?
2-(3-chlorophenyl)-1,1-dimethylguanidine has a molecular weight of 197.67 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-1,1-dimethylguanidine is sourced from PubChem (CID 3732126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).