C17H22FN7O3 — CID 3732306
4-N-(3-fluorophenyl)-2-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3732306) has the molecular formula C17H22FN7O3 and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-N-(3-fluorophenyl)-2-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(3-fluorophenyl)-2-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3732306 |
| Molecular Formula | C17H22FN7O3 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-N-(3-fluorophenyl)-2-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(NCCCN2CCOCC2)nc(Nc2cccc(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22FN7O3/c18-12-3-1-4-13(11-12)21-16-14(25(26)27)15(19)22-17(23-16)20-5-2-6-24-7-9-28-10-8-24/h1,3-4,11H,2,5-10H2,(H4,19,20,21,22,23) |
| InChIKey | BOFBGGWXWFWVCE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|