C23H29NO11 — CID 3732686
[2,3,4,5-tetraacetyloxy-6-(benzylamino)-6-oxohexyl] acetate (PubChem CID 3732686) has the molecular formula C23H29NO11 and a molecular weight of 495.48 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-(benzylamino)-6-oxohexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-(benzylamino)-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 3732686 |
| Molecular Formula | C23H29NO11 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-(benzylamino)-6-oxohexyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H29NO11/c1-13(25)31-12-19(32-14(2)26)20(33-15(3)27)21(34-16(4)28)22(35-17(5)29)23(30)24-11-18-9-7-6-8-10-18/h6-10,19-22H,11-12H2,1-5H3,(H,24,30) |
| InChIKey | IAXGPSHQEOQJTG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|