C25H20N2O6S — CID 37327796
[2-[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 37327796) has the molecular formula C25H20N2O6S and a molecular weight of 476.51 g/mol. Its IUPAC name is [2-[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 37327796 |
| Molecular Formula | C25H20N2O6S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [2-[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1nc(-c2ccc3c(c2)CCN3C(=O)COC(=O)COc2ccc3ccc(=O)oc3c2)cs1 |
| InChI | InChI=1S/C25H20N2O6S/c1-15-26-20(14-34-15)17-3-6-21-18(10-17)8-9-27(21)23(28)12-32-25(30)13-31-19-5-2-16-4-7-24(29)33-22(16)11-19/h2-7,10-11,14H,8-9,12-13H2,1H3 |
| InChIKey | KMGGUWPYPCUBSZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|