C12H8Cl3N3OS — CID 3732835
2-[4-[1-methyl-5-(2,2,2-trichloroacetyl)pyrrol-3-yl]-1,3-thiazol-2-yl]acetonitrile (PubChem CID 3732835) has the molecular formula C12H8Cl3N3OS and a molecular weight of 348.64 g/mol. Its IUPAC name is 2-[4-[1-methyl-5-(2,2,2-trichloroacetyl)pyrrol-3-yl]-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[4-[1-methyl-5-(2,2,2-trichloroacetyl)pyrrol-3-yl]-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 3732835 |
| Molecular Formula | C12H8Cl3N3OS |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2-[4-[1-methyl-5-(2,2,2-trichloroacetyl)pyrrol-3-yl]-1,3-thiazol-2-yl]acetonitrile |
| SMILES | Cn1cc(-c2csc(CC#N)n2)cc1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H8Cl3N3OS/c1-18-5-7(4-9(18)11(19)12(13,14)15)8-6-20-10(17-8)2-3-16/h4-6H,2H2,1H3 |
| InChIKey | QJHDABFASSUEKX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|