C20H22N6O4 — CID 3732883
propan-2-yl 2-[[5-nitro-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]acetate (PubChem CID 3732883) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is propan-2-yl 2-[[5-nitro-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]acetate.
| Compound Name | propan-2-yl 2-[[5-nitro-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 3732883 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | propan-2-yl 2-[[5-nitro-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]acetate |
| SMILES | CC(C)OC(=O)CNc1ncnc(N2CCc3c([nH]c4ccccc34)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N6O4/c1-12(2)30-17(27)9-21-19-18(26(28)29)20(23-11-22-19)25-8-7-14-13-5-3-4-6-15(13)24-16(14)10-25/h3-6,11-12,24H,7-10H2,1-2H3,(H,21,22,23) |
| InChIKey | OTHUENLFXUYVBZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|