C20H22N2O — CID 3733026
1-benzyl-2',2'-dimethylspiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 3733026) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-benzyl-2',2'-dimethylspiro[indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1-benzyl-2',2'-dimethylspiro[indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 3733026 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-benzyl-2',2'-dimethylspiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC1(C)NCCC12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C20H22N2O/c1-19(2)20(12-13-21-19)16-10-6-7-11-17(16)22(18(20)23)14-15-8-4-3-5-9-15/h3-11,21H,12-14H2,1-2H3 |
| InChIKey | DDUFVSMGVTZHAR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |