C15H11Cl2N5OS — CID 3733370
4-[2,2-dicyano-1-(2,3-dichlorophenyl)ethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide (PubChem CID 3733370) has the molecular formula C15H11Cl2N5OS and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-[2,2-dicyano-1-(2,3-dichlorophenyl)ethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide.
| Compound Name | 4-[2,2-dicyano-1-(2,3-dichlorophenyl)ethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 3733370 |
| Molecular Formula | C15H11Cl2N5OS |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 4-[2,2-dicyano-1-(2,3-dichlorophenyl)ethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide |
| SMILES | Cc1[nH]n(C(N)=S)c(=O)c1C(c1cccc(Cl)c1Cl)C(C#N)C#N |
| InChI | InChI=1S/C15H11Cl2N5OS/c1-7-11(14(23)22(21-7)15(20)24)12(8(5-18)6-19)9-3-2-4-10(16)13(9)17/h2-4,8,12,21H,1H3,(H2,20,24) |
| InChIKey | ITBLGUROVBGOEW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|