C27H28N4O2 — CID 37334061
1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]-2-[2-(phenoxymethyl)benzimidazol-1-yl]ethanone (PubChem CID 37334061) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]-2-[2-(phenoxymethyl)benzimidazol-1-yl]ethanone.
| Compound Name | 1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]-2-[2-(phenoxymethyl)benzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 37334061 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]-2-[2-(phenoxymethyl)benzimidazol-1-yl]ethanone |
| SMILES | CN1CCN(C(=O)Cn2c(COc3ccccc3)nc3ccccc32)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C27H28N4O2/c1-29-16-17-30(25(18-29)21-10-4-2-5-11-21)27(32)19-31-24-15-9-8-14-23(24)28-26(31)20-33-22-12-6-3-7-13-22/h2-15,25H,16-20H2,1H3/t25-/m0/s1 |
| InChIKey | DPTNYQQNAQPNNS-VWLOTQADSA-N |
| XLogP | 4.13 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |