C18H14FN5 — CID 3733447
6-amino-8-(2-fluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 3733447) has the molecular formula C18H14FN5 and a molecular weight of 319.34 g/mol. Its IUPAC name is 6-amino-8-(2-fluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-8-(2-fluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 3733447 |
| Molecular Formula | C18H14FN5 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-amino-8-(2-fluorophenyl)-2,3,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccccc2F)C2CNCC=C12 |
| InChI | InChI=1S/C18H14FN5/c19-15-4-2-1-3-12(15)16-14-8-24-6-5-11(14)13(7-20)17(23)18(16,9-21)10-22/h1-5,14,16,24H,6,8,23H2 |
| InChIKey | OQFZNBNDGIPUEI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|