About N-(5-propyl-1,3-thiazol-2-yl)acetamide
N-(5-propyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3733739) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is N-(5-propyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-propyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 3733739 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-(5-propyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCc1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-4-7-5-9-8(12-7)10-6(2)11/h5H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | WRHRGYSELKJYGL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-propyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-propyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(5-propyl-1,3-thiazol-2-yl)acetamide (CID 3733739) is N-(5-propyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(5-propyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(5-propyl-1,3-thiazol-2-yl)acetamide is CCCc1cnc(NC(C)=O)s1.
What is the InChIKey of N-(5-propyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is WRHRGYSELKJYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-3-4-7-5-9-8(12-7)10-6(2)11/h5H,3-4H2,1-2H3,(H,9,10,11).
What are the key properties of N-(5-propyl-1,3-thiazol-2-yl)acetamide?
N-(5-propyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 184.26 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-propyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 3733739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).