About 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione
2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione (PubChem CID 3733813) has the molecular formula C16H10N2O4
and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione |
| PubChem CID | 3733813 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione |
| SMILES | O=C1COc2ccc(N3C(=O)c4ccccc4C3=O)cc2N1 |
| InChI | InChI=1S/C16H10N2O4/c19-14-8-22-13-6-5-9(7-12(13)17-14)18-15(20)10-3-1-2-4-11(10)16(18)21/h1-7H,8H2,(H,17,19) |
| InChIKey | YURIZIHLOWOECY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione?
The IUPAC name of 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione (CID 3733813) is 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione.
What is the SMILES notation for 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione?
The canonical SMILES for 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione is O=C1COc2ccc(N3C(=O)c4ccccc4C3=O)cc2N1.
What is the InChIKey of 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione?
The InChIKey is YURIZIHLOWOECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4/c19-14-8-22-13-6-5-9(7-12(13)17-14)18-15(20)10-3-1-2-4-11(10)16(18)21/h1-7H,8H2,(H,17,19).
What are the key properties of 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione?
2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione has a molecular weight of 294.27 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4H-1,4-benzoxazin-6-yl)isoindole-1,3-dione is sourced from PubChem (CID 3733813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).