C22H30N6O4 — CID 3733977
2-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]-ethylamino]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 3733977) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]-ethylamino]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]-ethylamino]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 3733977 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]-ethylamino]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1c(C)cccc1C)c1ncnc(N2CC(C)OC(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30N6O4/c1-6-26(12-18(29)25-19-14(2)8-7-9-15(19)3)21-20(28(30)31)22(24-13-23-21)27-10-16(4)32-17(5)11-27/h7-9,13,16-17H,6,10-12H2,1-5H3,(H,25,29) |
| InChIKey | VYDNASVUKKOQKH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|