About (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone
(4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone (PubChem CID 3734527) has the molecular formula C30H27N5O
and a molecular weight of 473.58 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone.
Molecular Properties
| Compound Name | (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone |
| PubChem CID | 3734527 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone |
| SMILES | O=C(c1cnn2c(-c3ccccc3)cc(-c3ccccc3)nc12)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H27N5O/c36-30(34-18-16-33(17-19-34)22-23-10-4-1-5-11-23)26-21-31-35-28(25-14-8-3-9-15-25)20-27(32-29(26)35)24-12-6-2-7-13-24/h1-15,20-21H,16-19,22H2 |
| InChIKey | RKDPBGONEBCZCF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone?
The IUPAC name of (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone (CID 3734527) is (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone.
What is the SMILES notation for (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone?
The canonical SMILES for (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone is O=C(c1cnn2c(-c3ccccc3)cc(-c3ccccc3)nc12)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone?
The InChIKey is RKDPBGONEBCZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27N5O/c36-30(34-18-16-33(17-19-34)22-23-10-4-1-5-11-23)26-21-31-35-28(25-14-8-3-9-15-25)20-27(32-29(26)35)24-12-6-2-7-13-24/h1-15,20-21H,16-19,22H2.
What are the key properties of (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone?
(4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone has a molecular weight of 473.58 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylpiperazin-1-yl)-(5,7-diphenylpyrazolo[1,5-a]pyrimidin-3-yl)methanone is sourced from PubChem (CID 3734527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).