C19H16Cl3N3O4S — CID 3735003
5-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3735003) has the molecular formula C19H16Cl3N3O4S and a molecular weight of 488.78 g/mol. Its IUPAC name is 5-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3735003 |
| Molecular Formula | C19H16Cl3N3O4S |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | 5-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,6-dioxo-1-(2,3,5-trichlorophenyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ncsc1CCN1C(=O)C2C(C(=O)O)NC(c3cc(Cl)cc(Cl)c3Cl)C2C1=O |
| InChI | InChI=1S/C19H16Cl3N3O4S/c1-7-11(30-6-23-7)2-3-25-17(26)12-13(18(25)27)16(19(28)29)24-15(12)9-4-8(20)5-10(21)14(9)22/h4-6,12-13,15-16,24H,2-3H2,1H3,(H,28,29) |
| InChIKey | ITRGXLWCSJDXKH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|