C27H26N4O — CID 3735790
3-butyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 3735790) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-butyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine.
| Compound Name | 3-butyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 3735790 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-butyl-7-(furan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3ccco3)c2ncn1CCCC |
| InChI | InChI=1S/C27H26N4O/c1-2-3-16-30-19-29-27-24(26(30)28)23(20-11-6-4-7-12-20)25(21-13-8-5-9-14-21)31(27)18-22-15-10-17-32-22/h4-15,17,19,28H,2-3,16,18H2,1H3/b28-26- |
| InChIKey | FIJCPNBNBVXNII-SGEDCAFJSA-N |
| XLogP | 6.09 |
| TPSA | 59.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |