C16H34N2O4SSi — CID 3735848
6-hydroxy-4,4,6-trimethyl-1-(3-triethoxysilylpropyl)-1,3-diazinane-2-thione (PubChem CID 3735848) has the molecular formula C16H34N2O4SSi and a molecular weight of 378.61 g/mol. Its IUPAC name is 6-hydroxy-4,4,6-trimethyl-1-(3-triethoxysilylpropyl)-1,3-diazinane-2-thione.
| Compound Name | 6-hydroxy-4,4,6-trimethyl-1-(3-triethoxysilylpropyl)-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 3735848 |
| Molecular Formula | C16H34N2O4SSi |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 6-hydroxy-4,4,6-trimethyl-1-(3-triethoxysilylpropyl)-1,3-diazinane-2-thione |
| SMILES | CCO[Si](CCCN1C(=S)NC(C)(C)CC1(C)O)(OCC)OCC |
| InChI | InChI=1S/C16H34N2O4SSi/c1-7-20-24(21-8-2,22-9-3)12-10-11-18-14(23)17-15(4,5)13-16(18,6)19/h19H,7-13H2,1-6H3,(H,17,23) |
| InChIKey | VCYUTHOYHUIKSP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|