About 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea
1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea (PubChem CID 3736534) has the molecular formula C7H12N6O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea.
Molecular Properties
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea |
| PubChem CID | 3736534 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea |
| SMILES | CCC(C)=NNC(=O)Nc1nonc1N |
| InChI | InChI=1S/C7H12N6O2/c1-3-4(2)10-11-7(14)9-6-5(8)12-15-13-6/h3H2,1-2H3,(H2,8,12)(H2,9,11,13,14) |
| InChIKey | QLMXALMJSVKRIC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea?
The IUPAC name of 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea (CID 3736534) is 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea.
What is the SMILES notation for 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea?
The canonical SMILES for 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea is CCC(C)=NNC(=O)Nc1nonc1N.
What is the InChIKey of 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea?
The InChIKey is QLMXALMJSVKRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N6O2/c1-3-4(2)10-11-7(14)9-6-5(8)12-15-13-6/h3H2,1-2H3,(H2,8,12)(H2,9,11,13,14).
What are the key properties of 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea?
1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea has a molecular weight of 212.21 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-(butan-2-ylideneamino)urea is sourced from PubChem (CID 3736534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).