C17H12ClNO3 — CID 3736691
3-(4-chlorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,2-oxazol-5-one (PubChem CID 3736691) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,2-oxazol-5-one.
| Compound Name | 3-(4-chlorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 3736691 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,2-oxazol-5-one |
| SMILES | COc1ccccc1C=C1C(=O)ON=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClNO3/c1-21-15-5-3-2-4-12(15)10-14-16(19-22-17(14)20)11-6-8-13(18)9-7-11/h2-10H,1H3 |
| InChIKey | UCJSOQIIIQLZSX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|