About Camazepam
Camazepam (PubChem CID 37367) has the molecular formula C19H18ClN3O3
and a molecular weight of 371.80 g/mol. Its IUPAC name is (7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | Camazepam |
| PubChem CID | 37367 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) N,N-dimethylcarbamate |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)OC(=O)N(C)C)C3=CC=CC=C3 |
| InChI | InChI=1S/C19H18ClN3O3/c1-22(2)19(25)26-17-18(24)23(3)15-10-9-13(20)11-14(15)16(21-17)12-7-5-4-6-8-12/h4-11,17H,1-3H3 |
| InChIKey | PXBVEXGRHZFEOF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 574 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Camazepam with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Camazepam?
The IUPAC name of Camazepam (CID 37367) is (7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) N,N-dimethylcarbamate.
What is the SMILES notation for Camazepam?
The canonical SMILES for Camazepam is CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)OC(=O)N(C)C)C3=CC=CC=C3.
What is the InChIKey of Camazepam?
The InChIKey is PXBVEXGRHZFEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3O3/c1-22(2)19(25)26-17-18(24)23(3)15-10-9-13(20)11-14(15)16(21-17)12-7-5-4-6-8-12/h4-11,17H,1-3H3.
What are the key properties of Camazepam?
Camazepam has a molecular weight of 371.80 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Camazepam is sourced from PubChem (CID 37367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).