C23H18ClN5O2 — CID 3737187
17-(3-chlorophenyl)-13-(oxolan-2-ylmethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 3737187) has the molecular formula C23H18ClN5O2 and a molecular weight of 431.88 g/mol. Its IUPAC name is 17-(3-chlorophenyl)-13-(oxolan-2-ylmethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-(3-chlorophenyl)-13-(oxolan-2-ylmethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 3737187 |
| Molecular Formula | C23H18ClN5O2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 17-(3-chlorophenyl)-13-(oxolan-2-ylmethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | O=c1c2c3nc4ccccc4nc3n(-c3cccc(Cl)c3)c2ncn1CC1CCCO1 |
| InChI | InChI=1S/C23H18ClN5O2/c24-14-5-3-6-15(11-14)29-21-19(20-22(29)27-18-9-2-1-8-17(18)26-20)23(30)28(13-25-21)12-16-7-4-10-31-16/h1-3,5-6,8-9,11,13,16H,4,7,10,12H2 |
| InChIKey | SKOGNMJGRVTLRK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |