About 3,5-dimethoxy-2,6-dinitropyridine
3,5-dimethoxy-2,6-dinitropyridine (PubChem CID 3737763) has the molecular formula C7H7N3O6
and a molecular weight of 229.15 g/mol. Its IUPAC name is 3,5-dimethoxy-2,6-dinitropyridine.
Molecular Properties
| Compound Name | 3,5-dimethoxy-2,6-dinitropyridine |
| PubChem CID | 3737763 |
| Molecular Formula | C7H7N3O6 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3,5-dimethoxy-2,6-dinitropyridine |
| SMILES | COc1cc(OC)c([N+](=O)[O-])nc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O6/c1-15-4-3-5(16-2)7(10(13)14)8-6(4)9(11)12/h3H,1-2H3 |
| InChIKey | GSOCTSPEYIATME-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 117.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethoxy-2,6-dinitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethoxy-2,6-dinitropyridine?
The IUPAC name of 3,5-dimethoxy-2,6-dinitropyridine (CID 3737763) is 3,5-dimethoxy-2,6-dinitropyridine.
What is the SMILES notation for 3,5-dimethoxy-2,6-dinitropyridine?
The canonical SMILES for 3,5-dimethoxy-2,6-dinitropyridine is COc1cc(OC)c([N+](=O)[O-])nc1[N+](=O)[O-].
What is the InChIKey of 3,5-dimethoxy-2,6-dinitropyridine?
The InChIKey is GSOCTSPEYIATME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O6/c1-15-4-3-5(16-2)7(10(13)14)8-6(4)9(11)12/h3H,1-2H3.
What are the key properties of 3,5-dimethoxy-2,6-dinitropyridine?
3,5-dimethoxy-2,6-dinitropyridine has a molecular weight of 229.15 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxy-2,6-dinitropyridine is sourced from PubChem (CID 3737763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).