About N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide
N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 3737827) has the molecular formula C11H15NO5S2
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 3737827 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H15NO5S2/c1-17-10-4-2-9(3-5-10)12-19(15,16)11-6-7-18(13,14)8-11/h2-5,11-12H,6-8H2,1H3 |
| InChIKey | HPULWQDUYJRIPB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide (CID 3737827) is N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide is COc1ccc(NS(=O)(=O)C2CCS(=O)(=O)C2)cc1.
What is the InChIKey of N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is HPULWQDUYJRIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5S2/c1-17-10-4-2-9(3-5-10)12-19(15,16)11-6-7-18(13,14)8-11/h2-5,11-12H,6-8H2,1H3.
What are the key properties of N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide?
N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 305.38 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 3737827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).