About 3,4-dibromo-3-chlorothiolane 1,1-dioxide
3,4-dibromo-3-chlorothiolane 1,1-dioxide (PubChem CID 3738051) has the molecular formula C4H5Br2ClO2S
and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,4-dibromo-3-chlorothiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3,4-dibromo-3-chlorothiolane 1,1-dioxide |
| PubChem CID | 3738051 |
| Molecular Formula | C4H5Br2ClO2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 309.81 |
| IUPAC Name | 3,4-dibromo-3-chlorothiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC(Br)C(Cl)(Br)C1 |
| InChI | InChI=1S/C4H5Br2ClO2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2 |
| InChIKey | BPTGGFRVUKNIBY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-3-chlorothiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The IUPAC name of 3,4-dibromo-3-chlorothiolane 1,1-dioxide (CID 3738051) is 3,4-dibromo-3-chlorothiolane 1,1-dioxide.
What is the SMILES notation for 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The canonical SMILES for 3,4-dibromo-3-chlorothiolane 1,1-dioxide is O=S1(=O)CC(Br)C(Cl)(Br)C1.
What is the InChIKey of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The InChIKey is BPTGGFRVUKNIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5Br2ClO2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2.
What are the key properties of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
3,4-dibromo-3-chlorothiolane 1,1-dioxide has a molecular weight of 312.41 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-3-chlorothiolane 1,1-dioxide is sourced from PubChem (CID 3738051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).