3,4-dibromo-3-chlorothiolane 1,1-dioxide

C4H5Br2ClO2S — CID 3738051

IUPAC3,4-dibromo-3-chlorothiolane 1,1-dioxide
SMILESO=S1(=O)CC(Br)C(Cl)(Br)C1
InChIInChI=1S/C4H5Br2ClO2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2
InChIKeyBPTGGFRVUKNIBY-UHFFFAOYSA-N
MW312.41 g/mol
LogP1.51
Rot. Bonds

About 3,4-dibromo-3-chlorothiolane 1,1-dioxide

3,4-dibromo-3-chlorothiolane 1,1-dioxide (PubChem CID 3738051) has the molecular formula C4H5Br2ClO2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,4-dibromo-3-chlorothiolane 1,1-dioxide.

Molecular Properties

Compound Name3,4-dibromo-3-chlorothiolane 1,1-dioxide
PubChem CID3738051
Molecular FormulaC4H5Br2ClO2S
Molecular Weight312.41 g/mol
Exact Mass309.81
IUPAC Name3,4-dibromo-3-chlorothiolane 1,1-dioxide
SMILESO=S1(=O)CC(Br)C(Cl)(Br)C1
InChIInChI=1S/C4H5Br2ClO2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2
InChIKeyBPTGGFRVUKNIBY-UHFFFAOYSA-N
XLogP1.51
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.41
LogP ≤ 51.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3,4-dibromo-3-chlorothiolane 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The IUPAC name of 3,4-dibromo-3-chlorothiolane 1,1-dioxide (CID 3738051) is 3,4-dibromo-3-chlorothiolane 1,1-dioxide.
What is the SMILES notation for 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The canonical SMILES for 3,4-dibromo-3-chlorothiolane 1,1-dioxide is O=S1(=O)CC(Br)C(Cl)(Br)C1.
What is the InChIKey of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
The InChIKey is BPTGGFRVUKNIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5Br2ClO2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2.
What are the key properties of 3,4-dibromo-3-chlorothiolane 1,1-dioxide?
3,4-dibromo-3-chlorothiolane 1,1-dioxide has a molecular weight of 312.41 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-3-chlorothiolane 1,1-dioxide is sourced from PubChem (CID 3738051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).