About 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide
4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide (PubChem CID 3738190) has the molecular formula C15H12ClN5OS
and a molecular weight of 345.82 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide.
Molecular Properties
| Compound Name | 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide |
| PubChem CID | 3738190 |
| Molecular Formula | C15H12ClN5OS |
| Molecular Weight | 345.82 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide |
| SMILES | Cc1[nH]n(C(N)=S)c(=O)c1C(c1ccc(Cl)cc1)C(C#N)C#N |
| InChI | InChI=1S/C15H12ClN5OS/c1-8-12(14(22)21(20-8)15(19)23)13(10(6-17)7-18)9-2-4-11(16)5-3-9/h2-5,10,13,20H,1H3,(H2,19,23) |
| InChIKey | YRVZFEJUKBBRMC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide?
The IUPAC name of 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide (CID 3738190) is 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide.
What is the SMILES notation for 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide?
The canonical SMILES for 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide is Cc1[nH]n(C(N)=S)c(=O)c1C(c1ccc(Cl)cc1)C(C#N)C#N.
What is the InChIKey of 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide?
The InChIKey is YRVZFEJUKBBRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN5OS/c1-8-12(14(22)21(20-8)15(19)23)13(10(6-17)7-18)9-2-4-11(16)5-3-9/h2-5,10,13,20H,1H3,(H2,19,23).
What are the key properties of 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide?
4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide has a molecular weight of 345.82 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-chlorophenyl)-2,2-dicyanoethyl]-5-methyl-3-oxo-1H-pyrazole-2-carbothioamide is sourced from PubChem (CID 3738190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).