C18H16N4O2 — CID 3738250
3-ethyl-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 3738250) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-ethyl-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | 3-ethyl-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3738250 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-ethyl-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(CC)C1(C#N)C(C#N)(C#N)C2c1ccccc1 |
| InChI | InChI=1S/C18H16N4O2/c1-3-13-18(11-21)15(22)24-16(2,23-13)14(17(18,9-19)10-20)12-7-5-4-6-8-12/h4-8,13-14,22H,3H2,1-2H3/b22-15- |
| InChIKey | NCFDOXWUWRWZFU-JCMHNJIXSA-N |
| XLogP | 2.85 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|